C22H28N2O2 — CID 108968066
N-(2,6-dimethylphenyl)-2,2-dimethyl-N'-(2-propan-2-ylphenyl)propanediamide (PubChem CID 108968066) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2,2-dimethyl-N'-(2-propan-2-ylphenyl)propanediamide.
| Compound Name | N-(2,6-dimethylphenyl)-2,2-dimethyl-N'-(2-propan-2-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108968066 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2,2-dimethyl-N'-(2-propan-2-ylphenyl)propanediamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)(C)C(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C22H28N2O2/c1-14(2)17-12-7-8-13-18(17)23-20(25)22(5,6)21(26)24-19-15(3)10-9-11-16(19)4/h7-14H,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | JONNJWKFQPQEAQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|