C14H12N4O3S — CID 5138414
4-[(pyridine-4-carbonylamino)carbamothioylamino]benzoic acid (PubChem CID 5138414) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-[(pyridine-4-carbonylamino)carbamothioylamino]benzoic acid.
| Compound Name | 4-[(pyridine-4-carbonylamino)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 5138414 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-[(pyridine-4-carbonylamino)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)NNC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C14H12N4O3S/c19-12(9-5-7-15-8-6-9)17-18-14(22)16-11-3-1-10(2-4-11)13(20)21/h1-8H,(H,17,19)(H,20,21)(H2,16,18,22) |
| InChIKey | FPYDHWNRIAKJPE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|