C15H16N4OS — CID 7299485
1-[(1S)-1-phenylethyl]-3-(pyridine-4-carbonylamino)thiourea (PubChem CID 7299485) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-3-(pyridine-4-carbonylamino)thiourea.
| Compound Name | 1-[(1S)-1-phenylethyl]-3-(pyridine-4-carbonylamino)thiourea |
|---|---|
| PubChem CID | 7299485 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-3-(pyridine-4-carbonylamino)thiourea |
| SMILES | C[C@H](NC(=S)NNC(=O)c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N4OS/c1-11(12-5-3-2-4-6-12)17-15(21)19-18-14(20)13-7-9-16-10-8-13/h2-11H,1H3,(H,18,20)(H2,17,19,21)/t11-/m0/s1 |
| InChIKey | FLKDRZHKIDIHKL-NSHDSACASA-N |
| XLogP | 1.95 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|