C11H17N4O4PS — CID 5021610
1-diethoxyphosphoryl-3-(pyridine-4-carbonylamino)thiourea (PubChem CID 5021610) has the molecular formula C11H17N4O4PS and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-3-(pyridine-4-carbonylamino)thiourea.
| Compound Name | 1-diethoxyphosphoryl-3-(pyridine-4-carbonylamino)thiourea |
|---|---|
| PubChem CID | 5021610 |
| Molecular Formula | C11H17N4O4PS |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-diethoxyphosphoryl-3-(pyridine-4-carbonylamino)thiourea |
| SMILES | CCOP(=O)(NC(=S)NNC(=O)c1ccncc1)OCC |
| InChI | InChI=1S/C11H17N4O4PS/c1-3-18-20(17,19-4-2)15-11(21)14-13-10(16)9-5-7-12-8-6-9/h5-8H,3-4H2,1-2H3,(H,13,16)(H2,14,15,17,21) |
| InChIKey | GBEQNYPURWKUMW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|