C15H12ClN3O5S — CID 175208725
2-chloro-N-[[(3,4,5-trihydroxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 175208725) has the molecular formula C15H12ClN3O5S and a molecular weight of 381.80 g/mol. Its IUPAC name is 2-chloro-N-[[(3,4,5-trihydroxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[[(3,4,5-trihydroxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 175208725 |
| Molecular Formula | C15H12ClN3O5S |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-chloro-N-[[(3,4,5-trihydroxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1Cl)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H12ClN3O5S/c16-9-4-2-1-3-8(9)14(24)17-15(25)19-18-13(23)7-5-10(20)12(22)11(21)6-7/h1-6,20-22H,(H,18,23)(H2,17,19,24,25) |
| InChIKey | OWYJHFKYBWJSGE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|