C17H14IN3O2S — CID 6122714
(E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 6122714) has the molecular formula C17H14IN3O2S and a molecular weight of 451.29 g/mol. Its IUPAC name is (E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6122714 |
| Molecular Formula | C17H14IN3O2S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | (E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)NNC(=O)c1ccccc1I |
| InChI | InChI=1S/C17H14IN3O2S/c18-14-9-5-4-8-13(14)16(23)20-21-17(24)19-15(22)11-10-12-6-2-1-3-7-12/h1-11H,(H,20,23)(H2,19,21,22,24)/b11-10+ |
| InChIKey | BUIGHMBMRFVUQG-ZHACJKMWSA-N |
| XLogP | 2.64 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|