C16H14IN3O3S — CID 6291665
(E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 6291665) has the molecular formula C16H14IN3O3S and a molecular weight of 455.28 g/mol. Its IUPAC name is (E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6291665 |
| Molecular Formula | C16H14IN3O3S |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | (E)-N-[[(2-iodobenzoyl)amino]carbamothioyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(=S)NNC(=O)c2ccccc2I)o1 |
| InChI | InChI=1S/C16H14IN3O3S/c1-10-6-7-11(23-10)8-9-14(21)18-16(24)20-19-15(22)12-4-2-3-5-13(12)17/h2-9H,1H3,(H,19,22)(H2,18,20,21,24)/b9-8+ |
| InChIKey | SRTNJYLIOCORTH-CMDGGOBGSA-N |
| XLogP | 2.54 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|