C17H12I2N2O3S — CID 3251568
3,5-diiodo-2-(3-phenylprop-2-enoylcarbamothioylamino)benzoic acid (PubChem CID 3251568) has the molecular formula C17H12I2N2O3S and a molecular weight of 578.17 g/mol. Its IUPAC name is 3,5-diiodo-2-(3-phenylprop-2-enoylcarbamothioylamino)benzoic acid.
| Compound Name | 3,5-diiodo-2-(3-phenylprop-2-enoylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 3251568 |
| Molecular Formula | C17H12I2N2O3S |
| Molecular Weight | 578.17 g/mol |
| Exact Mass | 577.87 |
| IUPAC Name | 3,5-diiodo-2-(3-phenylprop-2-enoylcarbamothioylamino)benzoic acid |
| SMILES | O=C(C=Cc1ccccc1)NC(=S)Nc1c(I)cc(I)cc1C(=O)O |
| InChI | InChI=1S/C17H12I2N2O3S/c18-11-8-12(16(23)24)15(13(19)9-11)21-17(25)20-14(22)7-6-10-4-2-1-3-5-10/h1-9H,(H,23,24)(H2,20,21,22,25) |
| InChIKey | BXANBRHUVSWGBO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.17 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|