C18H17IN2OS — CID 1394955
(E)-N-[(2-ethyl-4-iodophenyl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 1394955) has the molecular formula C18H17IN2OS and a molecular weight of 436.32 g/mol. Its IUPAC name is (E)-N-[(2-ethyl-4-iodophenyl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2-ethyl-4-iodophenyl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 1394955 |
| Molecular Formula | C18H17IN2OS |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (E)-N-[(2-ethyl-4-iodophenyl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | CCc1cc(I)ccc1NC(=S)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H17IN2OS/c1-2-14-12-15(19)9-10-16(14)20-18(23)21-17(22)11-8-13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H2,20,21,22,23)/b11-8+ |
| InChIKey | BPEJNKZFLAEDSY-DHZHZOJOSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|