C20H21N3O4S — CID 17227688
(E)-3-(4-ethoxyphenyl)-N-[[(2-methoxybenzoyl)amino]carbamothioyl]prop-2-enamide (PubChem CID 17227688) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-[[(2-methoxybenzoyl)amino]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-[[(2-methoxybenzoyl)amino]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17227688 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-[[(2-methoxybenzoyl)amino]carbamothioyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(=S)NNC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-3-27-15-11-8-14(9-12-15)10-13-18(24)21-20(28)23-22-19(25)16-6-4-5-7-17(16)26-2/h4-13H,3H2,1-2H3,(H,22,25)(H2,21,23,24,28)/b13-10+ |
| InChIKey | SDVQQQNBLWPVGL-JLHYYAGUSA-N |
| XLogP | 2.44 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|