C27H27N3O5S — CID 6234822
2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide (PubChem CID 6234822) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 6234822 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=S)NC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H27N3O5S/c1-4-35-20-13-11-19(12-14-20)28-26(32)21-7-5-6-8-22(21)29-27(36)30-25(31)16-10-18-9-15-23(33-2)24(17-18)34-3/h5-17H,4H2,1-3H3,(H,28,32)(H2,29,30,31,36)/b16-10+ |
| InChIKey | HQHPWSPCWOUGEU-MHWRWJLKSA-N |
| XLogP | 4.88 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|