C26H25N3O4S — CID 6234826
N-(4-ethoxyphenyl)-2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzamide (PubChem CID 6234826) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 6234826 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]carbamothioylamino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=S)NC(=O)/C=C/c2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H25N3O4S/c1-3-33-20-15-13-19(14-16-20)27-25(31)21-9-5-6-10-22(21)28-26(34)29-24(30)17-12-18-8-4-7-11-23(18)32-2/h4-17H,3H2,1-2H3,(H,27,31)(H2,28,29,30,34)/b17-12+ |
| InChIKey | FLXYIIDGQCMIIG-SFQUDFHCSA-N |
| XLogP | 4.87 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|