C21H19BrClN3O3S2 — CID 17350573
5-bromo-2-butoxy-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]benzamide (PubChem CID 17350573) has the molecular formula C21H19BrClN3O3S2 and a molecular weight of 540.89 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350573 |
| Molecular Formula | C21H19BrClN3O3S2 |
| Molecular Weight | 540.89 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | 5-bromo-2-butoxy-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H19BrClN3O3S2/c1-2-3-10-29-15-9-8-12(22)11-14(15)19(27)24-21(30)26-25-20(28)18-17(23)13-6-4-5-7-16(13)31-18/h4-9,11H,2-3,10H2,1H3,(H,25,28)(H2,24,26,27,30) |
| InChIKey | OVGXHXSTFPLCJS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|