C25H19BrClN3O3S2 — CID 17046802
5-bromo-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17046802) has the molecular formula C25H19BrClN3O3S2 and a molecular weight of 588.94 g/mol. Its IUPAC name is 5-bromo-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17046802 |
| Molecular Formula | C25H19BrClN3O3S2 |
| Molecular Weight | 588.94 g/mol |
| Exact Mass | 586.97 |
| IUPAC Name | 5-bromo-N-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)NNC(=O)c1sc2ccccc2c1Cl)c1cc(Br)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C25H19BrClN3O3S2/c26-16-10-11-19(33-13-12-15-6-2-1-3-7-15)18(14-16)23(31)28-25(34)30-29-24(32)22-21(27)17-8-4-5-9-20(17)35-22/h1-11,14H,12-13H2,(H,29,32)(H2,28,30,31,34) |
| InChIKey | NUORDNJTWFJINI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.94 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|