C22H17BrCl2N2O2S — CID 17046675
5-bromo-N-[(2,3-dichlorophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17046675) has the molecular formula C22H17BrCl2N2O2S and a molecular weight of 524.27 g/mol. Its IUPAC name is 5-bromo-N-[(2,3-dichlorophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[(2,3-dichlorophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17046675 |
| Molecular Formula | C22H17BrCl2N2O2S |
| Molecular Weight | 524.27 g/mol |
| Exact Mass | 521.96 |
| IUPAC Name | 5-bromo-N-[(2,3-dichlorophenyl)carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1Cl)c1cc(Br)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C22H17BrCl2N2O2S/c23-15-9-10-19(29-12-11-14-5-2-1-3-6-14)16(13-15)21(28)27-22(30)26-18-8-4-7-17(24)20(18)25/h1-10,13H,11-12H2,(H2,26,27,28,30) |
| InChIKey | LYFHAMFKIFFYAO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.27 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|