C26H27BrN2O3S — CID 17142365
5-bromo-2-butoxy-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17142365) has the molecular formula C26H27BrN2O3S and a molecular weight of 527.48 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17142365 |
| Molecular Formula | C26H27BrN2O3S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 5-bromo-2-butoxy-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H27BrN2O3S/c1-2-3-15-32-24-13-12-20(27)17-23(24)25(30)29-26(33)28-21-10-7-11-22(18-21)31-16-14-19-8-5-4-6-9-19/h4-13,17-18H,2-3,14-16H2,1H3,(H2,28,29,30,33) |
| InChIKey | AOCFHPNWILLTNT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|