C23H22ClN3O4S2 — CID 4934930
3-phenylpropyl 4-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4934930) has the molecular formula C23H22ClN3O4S2 and a molecular weight of 504.03 g/mol. Its IUPAC name is 3-phenylpropyl 4-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4934930 |
| Molecular Formula | C23H22ClN3O4S2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 3-phenylpropyl 4-[[(3-chloro-1-benzothiophene-2-carbonyl)amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)NC(=S)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C23H22ClN3O4S2/c24-20-16-10-4-5-11-17(16)33-21(20)22(30)26-27-23(32)25-18(28)12-13-19(29)31-14-6-9-15-7-2-1-3-8-15/h1-5,7-8,10-11H,6,9,12-14H2,(H,26,30)(H2,25,27,28,32) |
| InChIKey | YHLROCHUJYQNGA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|