C21H22N4O6S — CID 4934944
3-phenylpropyl 4-[[(4-nitrobenzoyl)amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4934944) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-phenylpropyl 4-[[(4-nitrobenzoyl)amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[[(4-nitrobenzoyl)amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4934944 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 3-phenylpropyl 4-[[(4-nitrobenzoyl)amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)NC(=S)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22N4O6S/c26-18(12-13-19(27)31-14-4-7-15-5-2-1-3-6-15)22-21(32)24-23-20(28)16-8-10-17(11-9-16)25(29)30/h1-3,5-6,8-11H,4,7,12-14H2,(H,23,28)(H2,22,24,26,32) |
| InChIKey | HCNDGEMITVUAGQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|