C22H25N3O5S — CID 4933378
propyl 4-oxo-4-[[(4-phenylmethoxybenzoyl)amino]carbamothioylamino]butanoate (PubChem CID 4933378) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is propyl 4-oxo-4-[[(4-phenylmethoxybenzoyl)amino]carbamothioylamino]butanoate.
| Compound Name | propyl 4-oxo-4-[[(4-phenylmethoxybenzoyl)amino]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 4933378 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | propyl 4-oxo-4-[[(4-phenylmethoxybenzoyl)amino]carbamothioylamino]butanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)NNC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O5S/c1-2-14-29-20(27)13-12-19(26)23-22(31)25-24-21(28)17-8-10-18(11-9-17)30-15-16-6-4-3-5-7-16/h3-11H,2,12-15H2,1H3,(H,24,28)(H2,23,25,26,31) |
| InChIKey | ABPJMTWERPVBJX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|