C27H35N3O5S — CID 4928270
3-phenylpropyl 5-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioylamino]-5-oxopentanoate (PubChem CID 4928270) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is 3-phenylpropyl 5-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4928270 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-phenylpropyl 5-[[[4-(3-methylbutoxy)benzoyl]amino]carbamothioylamino]-5-oxopentanoate |
| SMILES | CC(C)CCOc1ccc(C(=O)NNC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H35N3O5S/c1-20(2)17-19-34-23-15-13-22(14-16-23)26(33)29-30-27(36)28-24(31)11-6-12-25(32)35-18-7-10-21-8-4-3-5-9-21/h3-5,8-9,13-16,20H,6-7,10-12,17-19H2,1-2H3,(H,29,33)(H2,28,30,31,36) |
| InChIKey | XZYBIEAETXFFPM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|