C29H31N3O5S — CID 4923632
3-phenylpropyl 5-oxo-5-[[[2-(4-phenylphenoxy)acetyl]amino]carbamothioylamino]pentanoate (PubChem CID 4923632) has the molecular formula C29H31N3O5S and a molecular weight of 533.65 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[[[2-(4-phenylphenoxy)acetyl]amino]carbamothioylamino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[[[2-(4-phenylphenoxy)acetyl]amino]carbamothioylamino]pentanoate |
|---|---|
| PubChem CID | 4923632 |
| Molecular Formula | C29H31N3O5S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[[[2-(4-phenylphenoxy)acetyl]amino]carbamothioylamino]pentanoate |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)NNC(=S)NC(=O)CCCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C29H31N3O5S/c33-26(14-7-15-28(35)36-20-8-11-22-9-3-1-4-10-22)30-29(38)32-31-27(34)21-37-25-18-16-24(17-19-25)23-12-5-2-6-13-23/h1-6,9-10,12-13,16-19H,7-8,11,14-15,20-21H2,(H,31,34)(H2,30,32,33,38) |
| InChIKey | OPJOBHJCRYRDTQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|