C15H20BrN3O2S — CID 17353233
5-bromo-2-ethoxy-N-(4-methylpiperazine-1-carbothioyl)benzamide (PubChem CID 17353233) has the molecular formula C15H20BrN3O2S and a molecular weight of 386.32 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(4-methylpiperazine-1-carbothioyl)benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-(4-methylpiperazine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 17353233 |
| Molecular Formula | C15H20BrN3O2S |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(4-methylpiperazine-1-carbothioyl)benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H20BrN3O2S/c1-3-21-13-5-4-11(16)10-12(13)14(20)17-15(22)19-8-6-18(2)7-9-19/h4-5,10H,3,6-9H2,1-2H3,(H,17,20,22) |
| InChIKey | FSPVSRMVPXMVII-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|