C20H21BrN2O2S — CID 17051149
5-bromo-N-(2,3-dihydroindole-1-carbothioyl)-2-(2-methylpropoxy)benzamide (PubChem CID 17051149) has the molecular formula C20H21BrN2O2S and a molecular weight of 433.37 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dihydroindole-1-carbothioyl)-2-(2-methylpropoxy)benzamide.
| Compound Name | 5-bromo-N-(2,3-dihydroindole-1-carbothioyl)-2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17051149 |
| Molecular Formula | C20H21BrN2O2S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 5-bromo-N-(2,3-dihydroindole-1-carbothioyl)-2-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)NC(=S)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H21BrN2O2S/c1-13(2)12-25-18-8-7-15(21)11-16(18)19(24)22-20(26)23-10-9-14-5-3-4-6-17(14)23/h3-8,11,13H,9-10,12H2,1-2H3,(H,22,24,26) |
| InChIKey | RNVZNLUXCUHQEV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|