C28H30BrN3O2S — CID 17355835
N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-propan-2-yloxybenzamide (PubChem CID 17355835) has the molecular formula C28H30BrN3O2S and a molecular weight of 552.54 g/mol. Its IUPAC name is N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-propan-2-yloxybenzamide.
| Compound Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17355835 |
| Molecular Formula | C28H30BrN3O2S |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C28H30BrN3O2S/c1-20(2)34-25-14-13-23(19-24(25)29)27(33)30-28(35)32-17-15-31(16-18-32)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-14,19-20,26H,15-18H2,1-2H3,(H,30,33,35) |
| InChIKey | OCRILSHRXZHOME-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|