C18H21NO4S — CID 110182583
morpholin-4-yl-(5,6,7-trimethoxynaphthalen-2-yl)methanethione (PubChem CID 110182583) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is morpholin-4-yl-(5,6,7-trimethoxynaphthalen-2-yl)methanethione.
| Compound Name | morpholin-4-yl-(5,6,7-trimethoxynaphthalen-2-yl)methanethione |
|---|---|
| PubChem CID | 110182583 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | morpholin-4-yl-(5,6,7-trimethoxynaphthalen-2-yl)methanethione |
| SMILES | COc1cc2cc(C(=S)N3CCOCC3)ccc2c(OC)c1OC |
| InChI | InChI=1S/C18H21NO4S/c1-20-15-11-13-10-12(18(24)19-6-8-23-9-7-19)4-5-14(13)16(21-2)17(15)22-3/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | KIXBAUVKBVXXFV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|