C23H27NO7S — CID 3112741
[2-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3112741) has the molecular formula C23H27NO7S and a molecular weight of 461.54 g/mol. Its IUPAC name is [2-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3112741 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [2-ethoxy-4-(morpholine-4-carbothioyl)phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOc1cc(C(=S)N2CCOCC2)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H27NO7S/c1-5-30-18-12-15(22(32)24-8-10-29-11-9-24)6-7-17(18)31-23(25)16-13-19(26-2)21(28-4)20(14-16)27-3/h6-7,12-14H,5,8-11H2,1-4H3 |
| InChIKey | GDZCKTJAECBXFR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|