C21H22N2O5S — CID 1127216
[2-ethoxy-4-(piperidine-1-carbothioyl)phenyl] 4-nitrobenzoate (PubChem CID 1127216) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is [2-ethoxy-4-(piperidine-1-carbothioyl)phenyl] 4-nitrobenzoate.
| Compound Name | [2-ethoxy-4-(piperidine-1-carbothioyl)phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 1127216 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-ethoxy-4-(piperidine-1-carbothioyl)phenyl] 4-nitrobenzoate |
| SMILES | CCOc1cc(C(=S)N2CCCCC2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22N2O5S/c1-2-27-19-14-16(20(29)22-12-4-3-5-13-22)8-11-18(19)28-21(24)15-6-9-17(10-7-15)23(25)26/h6-11,14H,2-5,12-13H2,1H3 |
| InChIKey | KAUGMVNLIHSBIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|