C24H27N3O6 — CID 37162660
2-[2-ethoxy-4-(6-nitro-2,3-dihydroindole-1-carbonyl)phenoxy]-1-piperidin-1-ylethanone (PubChem CID 37162660) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(6-nitro-2,3-dihydroindole-1-carbonyl)phenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-ethoxy-4-(6-nitro-2,3-dihydroindole-1-carbonyl)phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 37162660 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[2-ethoxy-4-(6-nitro-2,3-dihydroindole-1-carbonyl)phenoxy]-1-piperidin-1-ylethanone |
| SMILES | CCOc1cc(C(=O)N2CCc3ccc([N+](=O)[O-])cc32)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H27N3O6/c1-2-32-22-14-18(7-9-21(22)33-16-23(28)25-11-4-3-5-12-25)24(29)26-13-10-17-6-8-19(27(30)31)15-20(17)26/h6-9,14-15H,2-5,10-13,16H2,1H3 |
| InChIKey | UEGJMDXMCRZXLT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|