C29H31Cl2NO4 — CID 70442648
[4-[1,2-bis(4-methoxyphenyl)but-1-enyl]phenyl] N,N-bis(2-chloroethyl)carbamate (PubChem CID 70442648) has the molecular formula C29H31Cl2NO4 and a molecular weight of 528.48 g/mol. Its IUPAC name is [4-[1,2-bis(4-methoxyphenyl)but-1-enyl]phenyl] N,N-bis(2-chloroethyl)carbamate.
| Compound Name | [4-[1,2-bis(4-methoxyphenyl)but-1-enyl]phenyl] N,N-bis(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 70442648 |
| Molecular Formula | C29H31Cl2NO4 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | [4-[1,2-bis(4-methoxyphenyl)but-1-enyl]phenyl] N,N-bis(2-chloroethyl)carbamate |
| SMILES | CCC(=C(c1ccc(OC)cc1)c1ccc(OC(=O)N(CCCl)CCCl)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H31Cl2NO4/c1-4-27(21-5-11-24(34-2)12-6-21)28(22-7-13-25(35-3)14-8-22)23-9-15-26(16-10-23)36-29(33)32(19-17-30)20-18-31/h5-16H,4,17-20H2,1-3H3 |
| InChIKey | HRARABJJLWPZDR-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|