C25H26ClNO2 — CID 171715851
2-[4-[(Z)-1-(4-chlorophenyl)-2-(4-methoxyphenyl)but-1-enyl]phenoxy]ethanamine (PubChem CID 171715851) has the molecular formula C25H26ClNO2 and a molecular weight of 407.94 g/mol. Its IUPAC name is 2-[4-[(Z)-1-(4-chlorophenyl)-2-(4-methoxyphenyl)but-1-enyl]phenoxy]ethanamine.
| Compound Name | 2-[4-[(Z)-1-(4-chlorophenyl)-2-(4-methoxyphenyl)but-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 171715851 |
| Molecular Formula | C25H26ClNO2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[4-[(Z)-1-(4-chlorophenyl)-2-(4-methoxyphenyl)but-1-enyl]phenoxy]ethanamine |
| SMILES | CC/C(=C(/c1ccc(Cl)cc1)c1ccc(OCCN)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H26ClNO2/c1-3-24(18-6-12-22(28-2)13-7-18)25(19-4-10-21(26)11-5-19)20-8-14-23(15-9-20)29-17-16-27/h4-15H,3,16-17,27H2,1-2H3/b25-24+ |
| InChIKey | KPZPUXBJJDQVRX-OCOZRVBESA-N |
| XLogP | 6.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|