C32H30N2O — CID 145199755
5-[(E)-1-[4-(2-aminoethoxy)phenyl]-2-phenylbut-1-enyl]-2-benzylbenzonitrile (PubChem CID 145199755) has the molecular formula C32H30N2O and a molecular weight of 458.61 g/mol. Its IUPAC name is 5-[(E)-1-[4-(2-aminoethoxy)phenyl]-2-phenylbut-1-enyl]-2-benzylbenzonitrile.
| Compound Name | 5-[(E)-1-[4-(2-aminoethoxy)phenyl]-2-phenylbut-1-enyl]-2-benzylbenzonitrile |
|---|---|
| PubChem CID | 145199755 |
| Molecular Formula | C32H30N2O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 5-[(E)-1-[4-(2-aminoethoxy)phenyl]-2-phenylbut-1-enyl]-2-benzylbenzonitrile |
| SMILES | CC/C(=C(/c1ccc(OCCN)cc1)c1ccc(Cc2ccccc2)c(C#N)c1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O/c1-2-31(25-11-7-4-8-12-25)32(26-15-17-30(18-16-26)35-20-19-33)28-14-13-27(29(22-28)23-34)21-24-9-5-3-6-10-24/h3-18,22H,2,19-21,33H2,1H3/b32-31+ |
| InChIKey | KMJPYUWZWKWCDA-QNEJGDQOSA-N |
| XLogP | 6.86 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|