C34H40N2O3 — CID 134210444
4-(2-aminoethyl)benzene-1,2-diol;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 134210444) has the molecular formula C34H40N2O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 134210444 |
| Molecular Formula | C34H40N2O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H29NO.C8H11NO2/c1-4-25(21-11-7-5-8-12-21)26(22-13-9-6-10-14-22)23-15-17-24(18-16-23)28-20-19-27(2)3;9-4-3-6-1-2-7(10)8(11)5-6/h5-18H,4,19-20H2,1-3H3;1-2,5,10-11H,3-4,9H2/b26-25-; |
| InChIKey | ZVJZHWQHCNYJOW-OQKDUQJOSA-N |
| XLogP | 6.60 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|