C22H22ClNO2S — CID 123738243
4-[1-[4-(2-aminoethoxy)phenyl]-2-(5-chlorothiophen-3-yl)but-1-enyl]phenol (PubChem CID 123738243) has the molecular formula C22H22ClNO2S and a molecular weight of 399.94 g/mol. Its IUPAC name is 4-[1-[4-(2-aminoethoxy)phenyl]-2-(5-chlorothiophen-3-yl)but-1-enyl]phenol.
| Compound Name | 4-[1-[4-(2-aminoethoxy)phenyl]-2-(5-chlorothiophen-3-yl)but-1-enyl]phenol |
|---|---|
| PubChem CID | 123738243 |
| Molecular Formula | C22H22ClNO2S |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-[1-[4-(2-aminoethoxy)phenyl]-2-(5-chlorothiophen-3-yl)but-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN)cc1)c1csc(Cl)c1 |
| InChI | InChI=1S/C22H22ClNO2S/c1-2-20(17-13-21(23)27-14-17)22(15-3-7-18(25)8-4-15)16-5-9-19(10-6-16)26-12-11-24/h3-10,13-14,25H,2,11-12,24H2,1H3 |
| InChIKey | GORKPLODPDUOJR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |