C18H14F4 — CID 175685026
4-[2-[4-[(E)-but-2-enyl]phenyl]-1,2-difluoroethenyl]-1,2-difluorobenzene (PubChem CID 175685026) has the molecular formula C18H14F4 and a molecular weight of 306.30 g/mol. Its IUPAC name is 4-[2-[4-[(E)-but-2-enyl]phenyl]-1,2-difluoroethenyl]-1,2-difluorobenzene.
| Compound Name | 4-[2-[4-[(E)-but-2-enyl]phenyl]-1,2-difluoroethenyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 175685026 |
| Molecular Formula | C18H14F4 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[2-[4-[(E)-but-2-enyl]phenyl]-1,2-difluoroethenyl]-1,2-difluorobenzene |
| SMILES | C/C=C/Cc1ccc(C(F)=C(F)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H14F4/c1-2-3-4-12-5-7-13(8-6-12)17(21)18(22)14-9-10-15(19)16(20)11-14/h2-3,5-11H,4H2,1H3/b3-2+,18-17? |
| InChIKey | GPVMKWSRMITYAX-FZMWGMLVSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|