C15H9F5 — CID 139790731
5-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-1,2,3-trifluorobenzene (PubChem CID 139790731) has the molecular formula C15H9F5 and a molecular weight of 284.23 g/mol. Its IUPAC name is 5-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 139790731 |
| Molecular Formula | C15H9F5 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-1,2,3-trifluorobenzene |
| SMILES | Cc1ccc(/C(F)=C(\F)c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H9F5/c1-8-2-4-9(5-3-8)13(18)14(19)10-6-11(16)15(20)12(17)7-10/h2-7H,1H3/b14-13+ |
| InChIKey | UIDPLJVJCYUHBO-BUHFOSPRSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|