C24H15F5 — CID 134445114
5-[(E)-1,2-difluoro-2-[3-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]ethenyl]-1,2,3-trifluorobenzene (PubChem CID 134445114) has the molecular formula C24H15F5 and a molecular weight of 398.37 g/mol. Its IUPAC name is 5-[(E)-1,2-difluoro-2-[3-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]ethenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[(E)-1,2-difluoro-2-[3-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]ethenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 134445114 |
| Molecular Formula | C24H15F5 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 5-[(E)-1,2-difluoro-2-[3-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]ethenyl]-1,2,3-trifluorobenzene |
| SMILES | Cc1ccc(C#Cc2ccc(/C(F)=C(\F)c3cc(F)c(F)c(F)c3)cc2C)cc1 |
| InChI | InChI=1S/C24H15F5/c1-14-3-5-16(6-4-14)7-8-17-9-10-18(11-15(17)2)22(27)23(28)19-12-20(25)24(29)21(26)13-19/h3-6,9-13H,1-2H3/b23-22+ |
| InChIKey | OYWCUXLCYPGCDI-GHVJWSGMSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|