C19H18NO4- — CID 138971133
5-ethoxy-1-methoxy-5-oxo-3-phenyl-4-pyridin-2-ylpenta-1,2-dien-1-olate (PubChem CID 138971133) has the molecular formula C19H18NO4- and a molecular weight of 324.36 g/mol. Its IUPAC name is 5-ethoxy-1-methoxy-5-oxo-3-phenyl-4-pyridin-2-ylpenta-1,2-dien-1-olate.
| Compound Name | 5-ethoxy-1-methoxy-5-oxo-3-phenyl-4-pyridin-2-ylpenta-1,2-dien-1-olate |
|---|---|
| PubChem CID | 138971133 |
| Molecular Formula | C19H18NO4- |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-ethoxy-1-methoxy-5-oxo-3-phenyl-4-pyridin-2-ylpenta-1,2-dien-1-olate |
| SMILES | CCOC(=O)C(C(=C=C([O-])OC)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H19NO4/c1-3-24-19(22)18(16-11-7-8-12-20-16)15(13-17(21)23-2)14-9-5-4-6-10-14/h4-12,18,21H,3H2,1-2H3/p-1 |
| InChIKey | DCOJCKCLXCKSDO-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|