C32H30F3N3O6 — CID 173309464
methyl 2-ethoxyimino-2-[2-[1-[[2-prop-2-ynoxyimino-2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]amino]oxyethyl]phenyl]acetate (PubChem CID 173309464) has the molecular formula C32H30F3N3O6 and a molecular weight of 609.60 g/mol. Its IUPAC name is methyl 2-ethoxyimino-2-[2-[1-[[2-prop-2-ynoxyimino-2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]amino]oxyethyl]phenyl]acetate.
| Compound Name | methyl 2-ethoxyimino-2-[2-[1-[[2-prop-2-ynoxyimino-2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]amino]oxyethyl]phenyl]acetate |
|---|---|
| PubChem CID | 173309464 |
| Molecular Formula | C32H30F3N3O6 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | methyl 2-ethoxyimino-2-[2-[1-[[2-prop-2-ynoxyimino-2-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethylidene]amino]oxyethyl]phenyl]acetate |
| SMILES | C#CCON=C(C=NOC(C)c1ccccc1C(=NOCC)C(=O)OC)c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C32H30F3N3O6/c1-5-18-43-37-29(24-14-16-26(17-15-24)41-21-23-10-9-11-25(19-23)32(33,34)35)20-36-44-22(3)27-12-7-8-13-28(27)30(31(39)40-4)38-42-6-2/h1,7-17,19-20,22H,6,18,21H2,2-4H3 |
| InChIKey | LEVNGEWESPUSGI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 100.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|