C33H38N2O6 — CID 142635848
methyl 2-[2-[1-[[2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-2-methoxyiminoethylidene]amino]oxyethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 142635848) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is methyl 2-[2-[1-[[2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-2-methoxyiminoethylidene]amino]oxyethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[1-[[2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-2-methoxyiminoethylidene]amino]oxyethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 142635848 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | methyl 2-[2-[1-[[2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-2-methoxyiminoethylidene]amino]oxyethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1C(C)ON=CC(=NOC)c1ccc(OCc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H38N2O6/c1-23(28-10-8-9-11-29(28)30(22-37-5)32(36)38-6)41-34-20-31(35-39-7)25-14-18-27(19-15-25)40-21-24-12-16-26(17-13-24)33(2,3)4/h8-20,22-23H,21H2,1-7H3 |
| InChIKey | RTDMGWHXMFTVFD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|