C25H33NO4 — CID 59532539
methyl (E)-2-[2-[[4-[(hexylamino)methyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 59532539) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is methyl (E)-2-[2-[[4-[(hexylamino)methyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[4-[(hexylamino)methyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 59532539 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | methyl (E)-2-[2-[[4-[(hexylamino)methyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCCCCCNCc1ccc(OCc2ccccc2/C(=C\OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-4-5-6-9-16-26-17-20-12-14-22(15-13-20)30-18-21-10-7-8-11-23(21)24(19-28-2)25(27)29-3/h7-8,10-15,19,26H,4-6,9,16-18H2,1-3H3/b24-19+ |
| InChIKey | WMBNITJOBPQLCQ-LYBHJNIJSA-N |
| XLogP | 5.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|