C28H25F3N2O4S — CID 67083660
N-(2-naphthalen-1-ylethyl)-4-nitro-N-[3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide (PubChem CID 67083660) has the molecular formula C28H25F3N2O4S and a molecular weight of 542.58 g/mol. Its IUPAC name is N-(2-naphthalen-1-ylethyl)-4-nitro-N-[3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide.
| Compound Name | N-(2-naphthalen-1-ylethyl)-4-nitro-N-[3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67083660 |
| Molecular Formula | C28H25F3N2O4S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N-(2-naphthalen-1-ylethyl)-4-nitro-N-[3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N(CCCc2cccc(C(F)(F)F)c2)CCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H25F3N2O4S/c29-28(30,31)24-11-3-6-21(20-24)7-5-18-32(38(36,37)26-15-13-25(14-16-26)33(34)35)19-17-23-10-4-9-22-8-1-2-12-27(22)23/h1-4,6,8-16,20H,5,7,17-19H2 |
| InChIKey | QMSWXJQAVXOLON-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|