C25H28N2O2 — CID 42624000
N-hydroxy-4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide (PubChem CID 42624000) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-hydroxy-4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide.
| Compound Name | N-hydroxy-4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 42624000 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-hydroxy-4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide |
| SMILES | C[C@@H](NC1CCCC(c2ccc(C(=O)NO)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H28N2O2/c1-17(23-11-5-7-19-6-2-3-10-24(19)23)26-22-9-4-8-21(16-22)18-12-14-20(15-13-18)25(28)27-29/h2-3,5-7,10-15,17,21-22,26,29H,4,8-9,16H2,1H3,(H,27,28)/t17-,21?,22?/m1/s1 |
| InChIKey | RPTKEIDDDSXLCI-PPNDLDFTSA-N |
| XLogP | 5.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|