C17H22N2 — CID 156776321
(3S,5R)-5-methyl-N-(1-naphthalen-1-ylethyl)pyrrolidin-3-amine (PubChem CID 156776321) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (3S,5R)-5-methyl-N-(1-naphthalen-1-ylethyl)pyrrolidin-3-amine.
| Compound Name | (3S,5R)-5-methyl-N-(1-naphthalen-1-ylethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 156776321 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (3S,5R)-5-methyl-N-(1-naphthalen-1-ylethyl)pyrrolidin-3-amine |
| SMILES | CC(N[C@@H]1CN[C@H](C)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H22N2/c1-12-10-15(11-18-12)19-13(2)16-9-5-7-14-6-3-4-8-17(14)16/h3-9,12-13,15,18-19H,10-11H2,1-2H3/t12-,13?,15+/m1/s1 |
| InChIKey | WNMDBKAGEVRJDB-JHIQODARSA-N |
| XLogP | 3.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |