C16H22Cl2N2 — CID 67407230
(3R)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine;dihydrochloride (PubChem CID 67407230) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is (3R)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine;dihydrochloride.
| Compound Name | (3R)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 67407230 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (3R)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine;dihydrochloride |
| SMILES | C[C@@H](N[C@@H]1CCNC1)c1cccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C16H20N2.2ClH/c1-12(18-14-9-10-17-11-14)15-8-4-6-13-5-2-3-7-16(13)15;;/h2-8,12,14,17-18H,9-11H2,1H3;2*1H/t12-,14-;;/m1../s1 |
| InChIKey | QOLKLDKJLWSIHG-OJNIYTAOSA-N |
| XLogP | 3.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |