C10H18ClN3 — CID 71637660
(3S)-N-[1-(1H-pyrrol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 71637660) has the molecular formula C10H18ClN3 and a molecular weight of 215.73 g/mol. Its IUPAC name is (3S)-N-[1-(1H-pyrrol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-N-[1-(1H-pyrrol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71637660 |
| Molecular Formula | C10H18ClN3 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (3S)-N-[1-(1H-pyrrol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CC(N[C@H]1CCNC1)c1ccc[nH]1.Cl |
| InChI | InChI=1S/C10H17N3.ClH/c1-8(10-3-2-5-12-10)13-9-4-6-11-7-9;/h2-3,5,8-9,11-13H,4,6-7H2,1H3;1H/t8?,9-;/m0./s1 |
| InChIKey | XZPYBQDLPOQYBK-MTFPJWTKSA-N |
| XLogP | 1.45 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |