C11H19ClN2S — CID 71637623
(3R)-N-(1-thiophen-2-ylethyl)piperidin-3-amine;hydrochloride (PubChem CID 71637623) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is (3R)-N-(1-thiophen-2-ylethyl)piperidin-3-amine;hydrochloride.
| Compound Name | (3R)-N-(1-thiophen-2-ylethyl)piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71637623 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3R)-N-(1-thiophen-2-ylethyl)piperidin-3-amine;hydrochloride |
| SMILES | CC(N[C@@H]1CCCNC1)c1cccs1.Cl |
| InChI | InChI=1S/C11H18N2S.ClH/c1-9(11-5-3-7-14-11)13-10-4-2-6-12-8-10;/h3,5,7,9-10,12-13H,2,4,6,8H2,1H3;1H/t9?,10-;/m1./s1 |
| InChIKey | MNRHMBOPVXNRQQ-FJYJDOHQSA-N |
| XLogP | 2.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |