C12H21ClN2S — CID 71637837
N-(piperidin-3-ylmethyl)-1-thiophen-2-ylethanamine;hydrochloride (PubChem CID 71637837) has the molecular formula C12H21ClN2S and a molecular weight of 260.83 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-1-thiophen-2-ylethanamine;hydrochloride.
| Compound Name | N-(piperidin-3-ylmethyl)-1-thiophen-2-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 71637837 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-1-thiophen-2-ylethanamine;hydrochloride |
| SMILES | CC(NCC1CCCNC1)c1cccs1.Cl |
| InChI | InChI=1S/C12H20N2S.ClH/c1-10(12-5-3-7-15-12)14-9-11-4-2-6-13-8-11;/h3,5,7,10-11,13-14H,2,4,6,8-9H2,1H3;1H |
| InChIKey | PXGWRFIMSHIBPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |