C15H15FN2O — CID 124734601
5-fluoro-N-[(2S,3R)-2-phenyloxolan-3-yl]pyridin-2-amine (PubChem CID 124734601) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-fluoro-N-[(2S,3R)-2-phenyloxolan-3-yl]pyridin-2-amine.
| Compound Name | 5-fluoro-N-[(2S,3R)-2-phenyloxolan-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 124734601 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-fluoro-N-[(2S,3R)-2-phenyloxolan-3-yl]pyridin-2-amine |
| SMILES | Fc1ccc(N[C@@H]2CCO[C@H]2c2ccccc2)nc1 |
| InChI | InChI=1S/C15H15FN2O/c16-12-6-7-14(17-10-12)18-13-8-9-19-15(13)11-4-2-1-3-5-11/h1-7,10,13,15H,8-9H2,(H,17,18)/t13-,15+/m1/s1 |
| InChIKey | MNAIUYCRUQJMQQ-HIFRSBDPSA-N |
| XLogP | 3.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |