C18H22N4OS — CID 129479485
N-[(2R,3R)-2-phenyloxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-4-amine (PubChem CID 129479485) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is N-[(2R,3R)-2-phenyloxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[(2R,3R)-2-phenyloxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 129479485 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[(2R,3R)-2-phenyloxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-4-amine |
| SMILES | c1ccc([C@H]2OCC[C@H]2Nc2cc(N3CCSCC3)ncn2)cc1 |
| InChI | InChI=1S/C18H22N4OS/c1-2-4-14(5-3-1)18-15(6-9-23-18)21-16-12-17(20-13-19-16)22-7-10-24-11-8-22/h1-5,12-13,15,18H,6-11H2,(H,19,20,21)/t15-,18-/m1/s1 |
| InChIKey | GTQHUPQUAIHLQZ-CRAIPNDOSA-N |
| XLogP | 2.97 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |