C17H20N4O2S — CID 120964320
(2S)-3-phenyl-2-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]propanoic acid (PubChem CID 120964320) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 120964320 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2S)-3-phenyl-2-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)Nc1cc(N2CCSCC2)ncn1 |
| InChI | InChI=1S/C17H20N4O2S/c22-17(23)14(10-13-4-2-1-3-5-13)20-15-11-16(19-12-18-15)21-6-8-24-9-7-21/h1-5,11-12,14H,6-10H2,(H,22,23)(H,18,19,20)/t14-/m0/s1 |
| InChIKey | PQHGOXMGXMTIQY-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |